C19H24N5O3P — CID 134446550
4-[4-[ethoxy(methyl)phosphoryl]-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-2-yl]-3-methylmorpholine (PubChem CID 134446550) has the molecular formula C19H24N5O3P and a molecular weight of 401.41 g/mol. Its IUPAC name is 4-[4-[ethoxy(methyl)phosphoryl]-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-2-yl]-3-methylmorpholine.
| Compound Name | 4-[4-[ethoxy(methyl)phosphoryl]-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-2-yl]-3-methylmorpholine |
|---|---|
| PubChem CID | 134446550 |
| Molecular Formula | C19H24N5O3P |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 4-[4-[ethoxy(methyl)phosphoryl]-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-2-yl]-3-methylmorpholine |
| SMILES | CCOP(C)(=O)c1cc(N2CCOCC2C)nc2c(-c3ccn[nH]3)nccc12 |
| InChI | InChI=1S/C19H24N5O3P/c1-4-27-28(3,25)16-11-17(24-9-10-26-12-13(24)2)22-18-14(16)5-7-20-19(18)15-6-8-21-23-15/h5-8,11,13H,4,9-10,12H2,1-3H3,(H,21,23) |
| InChIKey | FREXWACQLKWHDO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|