C22H28N6O4 — CID 159883617
ethyl N-[3-[[2-[(3R)-3-methylmorpholin-4-yl]-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]oxy]propyl]carbamate (PubChem CID 159883617) has the molecular formula C22H28N6O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is ethyl N-[3-[[2-[(3R)-3-methylmorpholin-4-yl]-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]oxy]propyl]carbamate.
| Compound Name | ethyl N-[3-[[2-[(3R)-3-methylmorpholin-4-yl]-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]oxy]propyl]carbamate |
|---|---|
| PubChem CID | 159883617 |
| Molecular Formula | C22H28N6O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | ethyl N-[3-[[2-[(3R)-3-methylmorpholin-4-yl]-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]oxy]propyl]carbamate |
| SMILES | CCOC(=O)NCCCOc1cc(N2CCOC[C@H]2C)nc2c(-c3ccn[nH]3)nccc12 |
| InChI | InChI=1S/C22H28N6O4/c1-3-31-22(29)24-7-4-11-32-18-13-19(28-10-12-30-14-15(28)2)26-20-16(18)5-8-23-21(20)17-6-9-25-27-17/h5-6,8-9,13,15H,3-4,7,10-12,14H2,1-2H3,(H,24,29)(H,25,27)/t15-/m1/s1 |
| InChIKey | NTVUEXHBCKCEEA-OAHLLOKOSA-N |
| XLogP | 2.76 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|