C18H23N5O4P+ — CID 175221055
ethoxy-dihydroxy-[2-[(3R)-3-methylmorpholin-4-yl]-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]phosphanium (PubChem CID 175221055) has the molecular formula C18H23N5O4P+ and a molecular weight of 404.39 g/mol. Its IUPAC name is ethoxy-dihydroxy-[2-[(3R)-3-methylmorpholin-4-yl]-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]phosphanium.
| Compound Name | ethoxy-dihydroxy-[2-[(3R)-3-methylmorpholin-4-yl]-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]phosphanium |
|---|---|
| PubChem CID | 175221055 |
| Molecular Formula | C18H23N5O4P+ |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | ethoxy-dihydroxy-[2-[(3R)-3-methylmorpholin-4-yl]-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]phosphanium |
| SMILES | CCO[P+](O)(O)c1cc(N2CCOC[C@H]2C)nc2c(-c3ccn[nH]3)nccc12 |
| InChI | InChI=1S/C18H23N5O4P/c1-3-27-28(24,25)15-10-16(23-8-9-26-11-12(23)2)21-17-13(15)4-6-19-18(17)14-5-7-20-22-14/h4-7,10,12,24-25H,3,8-9,11H2,1-2H3,(H,20,22)/q+1/t12-/m1/s1 |
| InChIKey | MYCSNCCJSFCUAS-GFCCVEGCSA-N |
| XLogP | 1.65 |
| TPSA | 116.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|