C22H30N7O+ — CID 163496665
[3-imino-3-[2-(3-methylmorpholin-4-yl)-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]propyl]-propan-2-ylazanium (PubChem CID 163496665) has the molecular formula C22H30N7O+ and a molecular weight of 408.53 g/mol. Its IUPAC name is [3-imino-3-[2-(3-methylmorpholin-4-yl)-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]propyl]-propan-2-ylazanium.
| Compound Name | [3-imino-3-[2-(3-methylmorpholin-4-yl)-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]propyl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 163496665 |
| Molecular Formula | C22H30N7O+ |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | [3-imino-3-[2-(3-methylmorpholin-4-yl)-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]propyl]-propan-2-ylazanium |
| SMILES | [H]/N=C(\CC[NH2+]C(C)C)c1cc(N2CCOCC2C)nc2c(-c3ccn[nH]3)nccc12 |
| InChI | InChI=1S/C22H29N7O/c1-14(2)24-8-5-18(23)17-12-20(29-10-11-30-13-15(29)3)27-21-16(17)4-7-25-22(21)19-6-9-26-28-19/h4,6-7,9,12,14-15,23-24H,5,8,10-11,13H2,1-3H3,(H,26,28)/p+1/b23-18+ |
| InChIKey | CRHUYLUGWQFHJW-PTGBLXJZSA-O |
| XLogP | 1.97 |
| TPSA | 107.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|