C26H31N5O2 — CID 154487071
3-[4-(2-cyclopropylethynyl)-2-[(3R)-3-methylmorpholin-4-yl]-1,7-naphthyridin-8-yl]-3-(oxan-2-ylimino)prop-1-en-1-amine (PubChem CID 154487071) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 3-[4-(2-cyclopropylethynyl)-2-[(3R)-3-methylmorpholin-4-yl]-1,7-naphthyridin-8-yl]-3-(oxan-2-ylimino)prop-1-en-1-amine.
| Compound Name | 3-[4-(2-cyclopropylethynyl)-2-[(3R)-3-methylmorpholin-4-yl]-1,7-naphthyridin-8-yl]-3-(oxan-2-ylimino)prop-1-en-1-amine |
|---|---|
| PubChem CID | 154487071 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 3-[4-(2-cyclopropylethynyl)-2-[(3R)-3-methylmorpholin-4-yl]-1,7-naphthyridin-8-yl]-3-(oxan-2-ylimino)prop-1-en-1-amine |
| SMILES | C[C@@H]1COCCN1c1cc(C#CC2CC2)c2ccnc(C(C=CN)=NC3CCCCO3)c2n1 |
| InChI | InChI=1S/C26H31N5O2/c1-18-17-32-15-13-31(18)23-16-20(8-7-19-5-6-19)21-10-12-28-26(25(21)30-23)22(9-11-27)29-24-4-2-3-14-33-24/h9-12,16,18-19,24H,2-6,13-15,17,27H2,1H3/t18-,24?/m1/s1 |
| InChIKey | XJLFYDBJFQCQID-QFADGXAASA-N |
| XLogP | 3.40 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|