C21H28N6O — CID 134446678
(Z)-3-imino-1-[2-(3-methylmorpholin-4-yl)-4-piperidin-4-yl-1,7-naphthyridin-8-yl]prop-1-en-1-amine (PubChem CID 134446678) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is (Z)-3-imino-1-[2-(3-methylmorpholin-4-yl)-4-piperidin-4-yl-1,7-naphthyridin-8-yl]prop-1-en-1-amine.
| Compound Name | (Z)-3-imino-1-[2-(3-methylmorpholin-4-yl)-4-piperidin-4-yl-1,7-naphthyridin-8-yl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 134446678 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | (Z)-3-imino-1-[2-(3-methylmorpholin-4-yl)-4-piperidin-4-yl-1,7-naphthyridin-8-yl]prop-1-en-1-amine |
| SMILES | [H]/N=C/C=C(\N)c1nccc2c(C3CCNCC3)cc(N3CCOCC3C)nc12 |
| InChI | InChI=1S/C21H28N6O/c1-14-13-28-11-10-27(14)19-12-17(15-3-7-24-8-4-15)16-5-9-25-21(20(16)26-19)18(23)2-6-22/h2,5-6,9,12,14-15,22,24H,3-4,7-8,10-11,13,23H2,1H3/b18-2-,22-6+ |
| InChIKey | MQULTCPLNBSZHT-VBXGKPDWSA-N |
| XLogP | 2.27 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|