C19H21N7O — CID 174290634
(Z)-3-imino-1-[4-(2-methylpyrazol-3-yl)-2-morpholin-4-yl-1,7-naphthyridin-8-yl]prop-1-en-1-amine (PubChem CID 174290634) has the molecular formula C19H21N7O and a molecular weight of 363.43 g/mol. Its IUPAC name is (Z)-3-imino-1-[4-(2-methylpyrazol-3-yl)-2-morpholin-4-yl-1,7-naphthyridin-8-yl]prop-1-en-1-amine.
| Compound Name | (Z)-3-imino-1-[4-(2-methylpyrazol-3-yl)-2-morpholin-4-yl-1,7-naphthyridin-8-yl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 174290634 |
| Molecular Formula | C19H21N7O |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (Z)-3-imino-1-[4-(2-methylpyrazol-3-yl)-2-morpholin-4-yl-1,7-naphthyridin-8-yl]prop-1-en-1-amine |
| SMILES | [H]/N=C/C=C(\N)c1nccc2c(-c3ccnn3C)cc(N3CCOCC3)nc12 |
| InChI | InChI=1S/C19H21N7O/c1-25-16(4-7-23-25)14-12-17(26-8-10-27-11-9-26)24-18-13(14)3-6-22-19(18)15(21)2-5-20/h2-7,12,20H,8-11,21H2,1H3/b15-2-,20-5+ |
| InChIKey | CIBLTYKIYXKRNW-NAKTVEHFSA-N |
| XLogP | 1.82 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|