C25H24N6O — CID 134446481
(Z)-3-imino-1-[4-isoquinolin-4-yl-2-[(3R)-3-methylmorpholin-4-yl]-1,7-naphthyridin-8-yl]prop-1-en-1-amine (PubChem CID 134446481) has the molecular formula C25H24N6O and a molecular weight of 424.51 g/mol. Its IUPAC name is (Z)-3-imino-1-[4-isoquinolin-4-yl-2-[(3R)-3-methylmorpholin-4-yl]-1,7-naphthyridin-8-yl]prop-1-en-1-amine.
| Compound Name | (Z)-3-imino-1-[4-isoquinolin-4-yl-2-[(3R)-3-methylmorpholin-4-yl]-1,7-naphthyridin-8-yl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 134446481 |
| Molecular Formula | C25H24N6O |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | (Z)-3-imino-1-[4-isoquinolin-4-yl-2-[(3R)-3-methylmorpholin-4-yl]-1,7-naphthyridin-8-yl]prop-1-en-1-amine |
| SMILES | [H]/N=C/C=C(\N)c1nccc2c(-c3cncc4ccccc34)cc(N3CCOC[C@H]3C)nc12 |
| InChI | InChI=1S/C25H24N6O/c1-16-15-32-11-10-31(16)23-12-20(21-14-28-13-17-4-2-3-5-18(17)21)19-7-9-29-25(24(19)30-23)22(27)6-8-26/h2-9,12-14,16,26H,10-11,15,27H2,1H3/b22-6-,26-8+/t16-/m1/s1 |
| InChIKey | DMJKZNCOLKQXJH-SINZNFBGSA-N |
| XLogP | 4.02 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|