C22H35BO2Si — CID 134904088
dimethyl-phenyl-[2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]cyclohexyl]silane (PubChem CID 134904088) has the molecular formula C22H35BO2Si and a molecular weight of 370.42 g/mol. Its IUPAC name is dimethyl-phenyl-[2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]cyclohexyl]silane.
| Compound Name | dimethyl-phenyl-[2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]cyclohexyl]silane |
|---|---|
| PubChem CID | 134904088 |
| Molecular Formula | C22H35BO2Si |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | dimethyl-phenyl-[2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]cyclohexyl]silane |
| SMILES | C=C(B1OC(C)(C)C(C)(C)O1)C1CCCCC1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C22H35BO2Si/c1-17(23-24-21(2,3)22(4,5)25-23)19-15-11-12-16-20(19)26(6,7)18-13-9-8-10-14-18/h8-10,13-14,19-20H,1,11-12,15-16H2,2-7H3 |
| InChIKey | ADIZEKKORMMBBD-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|