C22H28Si — CID 122224745
3-cyclohexylprop-1-en-2-yl-methyl-diphenylsilane (PubChem CID 122224745) has the molecular formula C22H28Si and a molecular weight of 320.55 g/mol. Its IUPAC name is 3-cyclohexylprop-1-en-2-yl-methyl-diphenylsilane.
| Compound Name | 3-cyclohexylprop-1-en-2-yl-methyl-diphenylsilane |
|---|---|
| PubChem CID | 122224745 |
| Molecular Formula | C22H28Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 3-cyclohexylprop-1-en-2-yl-methyl-diphenylsilane |
| SMILES | C=C(CC1CCCCC1)[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28Si/c1-19(18-20-12-6-3-7-13-20)23(2,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h4-5,8-11,14-17,20H,1,3,6-7,12-13,18H2,2H3 |
| InChIKey | ZNPLDXKRMWOBJC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|