C23H30Si — CID 162694845
(4-cyclopentyl-2-methylidenebutyl)-methyl-diphenylsilane (PubChem CID 162694845) has the molecular formula C23H30Si and a molecular weight of 334.58 g/mol. Its IUPAC name is (4-cyclopentyl-2-methylidenebutyl)-methyl-diphenylsilane.
| Compound Name | (4-cyclopentyl-2-methylidenebutyl)-methyl-diphenylsilane |
|---|---|
| PubChem CID | 162694845 |
| Molecular Formula | C23H30Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (4-cyclopentyl-2-methylidenebutyl)-methyl-diphenylsilane |
| SMILES | C=C(CCC1CCCC1)C[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30Si/c1-20(17-18-21-11-9-10-12-21)19-24(2,22-13-5-3-6-14-22)23-15-7-4-8-16-23/h3-8,13-16,21H,1,9-12,17-19H2,2H3 |
| InChIKey | PTCPAPDZWWDDTA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|