C25H36Si2 — CID 102497946
[(Z)-3-cyclohexyl-1-[dimethyl(phenyl)silyl]prop-1-en-2-yl]-dimethyl-phenylsilane (PubChem CID 102497946) has the molecular formula C25H36Si2 and a molecular weight of 392.74 g/mol. Its IUPAC name is [(Z)-3-cyclohexyl-1-[dimethyl(phenyl)silyl]prop-1-en-2-yl]-dimethyl-phenylsilane.
| Compound Name | [(Z)-3-cyclohexyl-1-[dimethyl(phenyl)silyl]prop-1-en-2-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 102497946 |
| Molecular Formula | C25H36Si2 |
| Molecular Weight | 392.74 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | [(Z)-3-cyclohexyl-1-[dimethyl(phenyl)silyl]prop-1-en-2-yl]-dimethyl-phenylsilane |
| SMILES | C[Si](C)(/C=C(/CC1CCCCC1)[Si](C)(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H36Si2/c1-26(2,23-16-10-6-11-17-23)21-25(20-22-14-8-5-9-15-22)27(3,4)24-18-12-7-13-19-24/h6-7,10-13,16-19,21-22H,5,8-9,14-15,20H2,1-4H3/b25-21- |
| InChIKey | XCKAUMVBAWUEIT-DAFNUICNSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.74 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|