C22H33BO2Si — CID 11485466
[2-cyclohexylidene-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-dimethyl-phenylsilane (PubChem CID 11485466) has the molecular formula C22H33BO2Si and a molecular weight of 368.40 g/mol. Its IUPAC name is [2-cyclohexylidene-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-dimethyl-phenylsilane.
| Compound Name | [2-cyclohexylidene-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 11485466 |
| Molecular Formula | C22H33BO2Si |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | [2-cyclohexylidene-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-dimethyl-phenylsilane |
| SMILES | CC1(C)OB(C(=C=C2CCCCC2)[Si](C)(C)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C22H33BO2Si/c1-21(2)22(3,4)25-23(24-21)20(17-18-13-9-7-10-14-18)26(5,6)19-15-11-8-12-16-19/h8,11-12,15-16H,7,9-10,13-14H2,1-6H3 |
| InChIKey | VFGDLDWZUZNWJD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|