C42H43BO2Si — CID 135061365
dimethyl-phenyl-[(1Z,3E)-1,2,3,4-tetraphenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)buta-1,3-dienyl]silane (PubChem CID 135061365) has the molecular formula C42H43BO2Si and a molecular weight of 618.70 g/mol. Its IUPAC name is dimethyl-phenyl-[(1Z,3E)-1,2,3,4-tetraphenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)buta-1,3-dienyl]silane.
| Compound Name | dimethyl-phenyl-[(1Z,3E)-1,2,3,4-tetraphenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)buta-1,3-dienyl]silane |
|---|---|
| PubChem CID | 135061365 |
| Molecular Formula | C42H43BO2Si |
| Molecular Weight | 618.70 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | dimethyl-phenyl-[(1Z,3E)-1,2,3,4-tetraphenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)buta-1,3-dienyl]silane |
| SMILES | CC1(C)OB(/C(=C(C(=C(\c2ccccc2)[Si](C)(C)c2ccccc2)\c2ccccc2)/c2ccccc2)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C42H43BO2Si/c1-41(2)42(3,4)45-43(44-41)39(34-26-16-9-17-27-34)37(32-22-12-7-13-23-32)38(33-24-14-8-15-25-33)40(35-28-18-10-19-29-35)46(5,6)36-30-20-11-21-31-36/h7-31H,1-6H3/b39-37-,40-38- |
| InChIKey | ZNUZIDBZGIKAES-YKSAKOAQSA-N |
| XLogP | 9.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.70 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|