C27H29BO2S — CID 171341442
4,4,5,5-tetramethyl-2-[(E)-2-(4-methylphenyl)sulfanyl-1,2-diphenylethenyl]-1,3,2-dioxaborolane (PubChem CID 171341442) has the molecular formula C27H29BO2S and a molecular weight of 428.41 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(E)-2-(4-methylphenyl)sulfanyl-1,2-diphenylethenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(E)-2-(4-methylphenyl)sulfanyl-1,2-diphenylethenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171341442 |
| Molecular Formula | C27H29BO2S |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(E)-2-(4-methylphenyl)sulfanyl-1,2-diphenylethenyl]-1,3,2-dioxaborolane |
| SMILES | Cc1ccc(S/C(=C(\B2OC(C)(C)C(C)(C)O2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29BO2S/c1-20-16-18-23(19-17-20)31-25(22-14-10-7-11-15-22)24(21-12-8-6-9-13-21)28-29-26(2,3)27(4,5)30-28/h6-19H,1-5H3/b25-24- |
| InChIKey | RTRNHMHYPVOWDH-IZHYLOQSSA-N |
| XLogP | 7.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|