C33H34BNO2 — CID 142733388
N-(2,2-diphenylethenyl)-N-(4-methylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 142733388) has the molecular formula C33H34BNO2 and a molecular weight of 487.45 g/mol. Its IUPAC name is N-(2,2-diphenylethenyl)-N-(4-methylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | N-(2,2-diphenylethenyl)-N-(4-methylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 142733388 |
| Molecular Formula | C33H34BNO2 |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | N-(2,2-diphenylethenyl)-N-(4-methylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | Cc1ccc(N(C=C(c2ccccc2)c2ccccc2)c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C33H34BNO2/c1-25-16-20-29(21-17-25)35(24-31(26-12-8-6-9-13-26)27-14-10-7-11-15-27)30-22-18-28(19-23-30)34-36-32(2,3)33(4,5)37-34/h6-24H,1-5H3 |
| InChIKey | NDXDABYJQBIWHQ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenone(7)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|