C20H36BN3O4 — CID 163541426
tert-butyl 4-[[(Z)-3-methylimino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]amino]piperidine-1-carboxylate (PubChem CID 163541426) has the molecular formula C20H36BN3O4 and a molecular weight of 393.34 g/mol. Its IUPAC name is tert-butyl 4-[[(Z)-3-methylimino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(Z)-3-methylimino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163541426 |
| Molecular Formula | C20H36BN3O4 |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | tert-butyl 4-[[(Z)-3-methylimino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]amino]piperidine-1-carboxylate |
| SMILES | C/N=C/C(=C\NC1CCN(C(=O)OC(C)(C)C)CC1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H36BN3O4/c1-18(2,3)26-17(25)24-11-9-16(10-12-24)23-14-15(13-22-8)21-27-19(4,5)20(6,7)28-21/h13-14,16,23H,9-12H2,1-8H3/b15-14+,22-13+ |
| InChIKey | FBKFIIYGNWLTJI-OPLPYYIESA-N |
| XLogP | 3.19 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|