C20H37BIN3O4 — CID 145401721
tert-butyl 4-[(2Z)-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enylidene]hydrazinyl]piperidine-1-carboxylate;iodomethane (PubChem CID 145401721) has the molecular formula C20H37BIN3O4 and a molecular weight of 521.25 g/mol. Its IUPAC name is tert-butyl 4-[(2Z)-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enylidene]hydrazinyl]piperidine-1-carboxylate;iodomethane.
| Compound Name | tert-butyl 4-[(2Z)-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enylidene]hydrazinyl]piperidine-1-carboxylate;iodomethane |
|---|---|
| PubChem CID | 145401721 |
| Molecular Formula | C20H37BIN3O4 |
| Molecular Weight | 521.25 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | tert-butyl 4-[(2Z)-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enylidene]hydrazinyl]piperidine-1-carboxylate;iodomethane |
| SMILES | C=C(/C=N\NC1CCN(C(=O)OC(C)(C)C)CC1)B1OC(C)(C)C(C)(C)O1.CI |
| InChI | InChI=1S/C19H34BN3O4.CH3I/c1-14(20-26-18(5,6)19(7,8)27-20)13-21-22-15-9-11-23(12-10-15)16(24)25-17(2,3)4;1-2/h13,15,22H,1,9-12H2,2-8H3;1H3/b21-13-; |
| InChIKey | NTNQCTMGTCNSDZ-GNWMQEPYSA-N |
| XLogP | 4.20 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.25 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|