C15H25BO2 — CID 174035687
4,4,5,5-tetramethyl-2-(5-methyl-1,3a,4,5,6,6a-hexahydropentalen-2-yl)-1,3,2-dioxaborolane (PubChem CID 174035687) has the molecular formula C15H25BO2 and a molecular weight of 248.17 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(5-methyl-1,3a,4,5,6,6a-hexahydropentalen-2-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(5-methyl-1,3a,4,5,6,6a-hexahydropentalen-2-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 174035687 |
| Molecular Formula | C15H25BO2 |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(5-methyl-1,3a,4,5,6,6a-hexahydropentalen-2-yl)-1,3,2-dioxaborolane |
| SMILES | CC1CC2C=C(B3OC(C)(C)C(C)(C)O3)CC2C1 |
| InChI | InChI=1S/C15H25BO2/c1-10-6-11-8-13(9-12(11)7-10)16-17-14(2,3)15(4,5)18-16/h8,10-12H,6-7,9H2,1-5H3 |
| InChIKey | UMAOSUCEAAGTQZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|