C17H26BN3O4 — CID 66686958
N-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoylamino]ethyl]acetamide (PubChem CID 66686958) has the molecular formula C17H26BN3O4 and a molecular weight of 347.22 g/mol. Its IUPAC name is N-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoylamino]ethyl]acetamide.
| Compound Name | N-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 66686958 |
| Molecular Formula | C17H26BN3O4 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNC(=O)Nc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C17H26BN3O4/c1-12(22)19-10-11-20-15(23)21-14-8-6-13(7-9-14)18-24-16(2,3)17(4,5)25-18/h6-9H,10-11H2,1-5H3,(H,19,22)(H2,20,21,23) |
| InChIKey | GOEUBDMHYUYYHZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|