C19H25BN2O4 — CID 86700839
2-ethyl-4-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-oxazole-5-carboxamide (PubChem CID 86700839) has the molecular formula C19H25BN2O4 and a molecular weight of 356.23 g/mol. Its IUPAC name is 2-ethyl-4-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-oxazole-5-carboxamide.
| Compound Name | 2-ethyl-4-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 86700839 |
| Molecular Formula | C19H25BN2O4 |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 2-ethyl-4-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-oxazole-5-carboxamide |
| SMILES | CCc1nc(C)c(C(=O)Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)o1 |
| InChI | InChI=1S/C19H25BN2O4/c1-7-15-21-12(2)16(24-15)17(23)22-14-10-8-13(9-11-14)20-25-18(3,4)19(5,6)26-20/h8-11H,7H2,1-6H3,(H,22,23) |
| InChIKey | VJIMTODWPBQTJD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|