C22H28BNO5S — CID 71285701
2-(4-ethylsulfonylphenyl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (PubChem CID 71285701) has the molecular formula C22H28BNO5S and a molecular weight of 429.35 g/mol. Its IUPAC name is 2-(4-ethylsulfonylphenyl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide.
| Compound Name | 2-(4-ethylsulfonylphenyl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 71285701 |
| Molecular Formula | C22H28BNO5S |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 2-(4-ethylsulfonylphenyl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C22H28BNO5S/c1-6-30(26,27)19-13-7-16(8-14-19)15-20(25)24-18-11-9-17(10-12-18)23-28-21(2,3)22(4,5)29-23/h7-14H,6,15H2,1-5H3,(H,24,25) |
| InChIKey | NZDKYVSDTCOBJA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|