C22H25BN2O3 — CID 174115580
3-(4-cyanophenyl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide (PubChem CID 174115580) has the molecular formula C22H25BN2O3 and a molecular weight of 376.27 g/mol. Its IUPAC name is 3-(4-cyanophenyl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide.
| Compound Name | 3-(4-cyanophenyl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 174115580 |
| Molecular Formula | C22H25BN2O3 |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 3-(4-cyanophenyl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide |
| SMILES | CC1(C)OB(c2ccc(NC(=O)CCc3ccc(C#N)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C22H25BN2O3/c1-21(2)22(3,4)28-23(27-21)18-10-12-19(13-11-18)25-20(26)14-9-16-5-7-17(15-24)8-6-16/h5-8,10-13H,9,14H2,1-4H3,(H,25,26) |
| InChIKey | AGKQTBFLYONOFY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|