C28H29BBrNO5 — CID 154573599
[2-oxo-1-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl] 2-(4-bromophenyl)acetate (PubChem CID 154573599) has the molecular formula C28H29BBrNO5 and a molecular weight of 550.26 g/mol. Its IUPAC name is [2-oxo-1-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl] 2-(4-bromophenyl)acetate.
| Compound Name | [2-oxo-1-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl] 2-(4-bromophenyl)acetate |
|---|---|
| PubChem CID | 154573599 |
| Molecular Formula | C28H29BBrNO5 |
| Molecular Weight | 550.26 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | [2-oxo-1-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl] 2-(4-bromophenyl)acetate |
| SMILES | CC1(C)OB(c2ccc(NC(=O)C(OC(=O)Cc3ccc(Br)cc3)c3ccccc3)cc2)OC1(C)C |
| InChI | InChI=1S/C28H29BBrNO5/c1-27(2)28(3,4)36-29(35-27)21-12-16-23(17-13-21)31-26(33)25(20-8-6-5-7-9-20)34-24(32)18-19-10-14-22(30)15-11-19/h5-17,25H,18H2,1-4H3,(H,31,33) |
| InChIKey | VJJFYAQBPSSZIU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.26 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|