C24H26BNO3 — CID 140776472
N-(4-methylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxamide (PubChem CID 140776472) has the molecular formula C24H26BNO3 and a molecular weight of 387.29 g/mol. Its IUPAC name is N-(4-methylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxamide.
| Compound Name | N-(4-methylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 140776472 |
| Molecular Formula | C24H26BNO3 |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | N-(4-methylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cccc3cc(B4OC(C)(C)C(C)(C)O4)ccc23)cc1 |
| InChI | InChI=1S/C24H26BNO3/c1-16-9-12-19(13-10-16)26-22(27)21-8-6-7-17-15-18(11-14-20(17)21)25-28-23(2,3)24(4,5)29-25/h6-15H,1-5H3,(H,26,27) |
| InChIKey | RLPSKENFPVVJRS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|