C19H20BClFNO3 — CID 169074886
N-(3-chlorophenyl)-2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 169074886) has the molecular formula C19H20BClFNO3 and a molecular weight of 375.64 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | N-(3-chlorophenyl)-2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 169074886 |
| Molecular Formula | C19H20BClFNO3 |
| Molecular Weight | 375.64 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-(3-chlorophenyl)-2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CC1(C)OB(c2ccc(F)c(C(=O)Nc3cccc(Cl)c3)c2)OC1(C)C |
| InChI | InChI=1S/C19H20BClFNO3/c1-18(2)19(3,4)26-20(25-18)12-8-9-16(22)15(10-12)17(24)23-14-7-5-6-13(21)11-14/h5-11H,1-4H3,(H,23,24) |
| InChIKey | JFVFUIOXSHWIGM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.64 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|