C21H24BClFNO4 — CID 131734605
N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 131734605) has the molecular formula C21H24BClFNO4 and a molecular weight of 419.69 g/mol. Its IUPAC name is N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 131734605 |
| Molecular Formula | C21H24BClFNO4 |
| Molecular Weight | 419.69 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CC1(C)OB(c2ccc(C(=O)N[C@H](CO)c3cccc(Cl)c3)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C21H24BClFNO4/c1-20(2)21(3,4)29-22(28-20)14-8-9-16(17(24)11-14)19(27)25-18(12-26)13-6-5-7-15(23)10-13/h5-11,18,26H,12H2,1-4H3,(H,25,27)/t18-/m1/s1 |
| InChIKey | GWNOYHLJEJFLKY-GOSISDBHSA-N |
| XLogP | 3.24 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.69 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|