C26H28BClFN3O4 — CID 123315577
4-[2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide (PubChem CID 123315577) has the molecular formula C26H28BClFN3O4 and a molecular weight of 511.79 g/mol. Its IUPAC name is 4-[2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide.
| Compound Name | 4-[2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 123315577 |
| Molecular Formula | C26H28BClFN3O4 |
| Molecular Weight | 511.79 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 4-[2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide |
| SMILES | CC1(C)OB(c2cnc(N)c(-c3ccc(C(=O)N[C@H](CO)c4cccc(Cl)c4)c(F)c3)c2)OC1(C)C |
| InChI | InChI=1S/C26H28BClFN3O4/c1-25(2)26(3,4)36-27(35-25)17-12-20(23(30)31-13-17)15-8-9-19(21(29)11-15)24(34)32-22(14-33)16-6-5-7-18(28)10-16/h5-13,22,33H,14H2,1-4H3,(H2,30,31)(H,32,34)/t22-/m1/s1 |
| InChIKey | IPLIGZWBXMPGCE-JOCHJYFZSA-N |
| XLogP | 3.89 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.79 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|