C16H24BNO3 — CID 177477440
N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanamide (PubChem CID 177477440) has the molecular formula C16H24BNO3 and a molecular weight of 289.18 g/mol. Its IUPAC name is N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanamide.
| Compound Name | N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 177477440 |
| Molecular Formula | C16H24BNO3 |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C16H24BNO3/c1-6-8-14(19)18-13-10-7-9-12(11-13)17-20-15(2,3)16(4,5)21-17/h7,9-11H,6,8H2,1-5H3,(H,18,19) |
| InChIKey | LLOUWYHAXXXGRG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|