C11H12NO3- — CID 5092431
3-(butanoylamino)benzoate (PubChem CID 5092431) has the molecular formula C11H12NO3- and a molecular weight of 206.22 g/mol. Its IUPAC name is 3-(butanoylamino)benzoate.
| Compound Name | 3-(butanoylamino)benzoate |
|---|---|
| PubChem CID | 5092431 |
| Molecular Formula | C11H12NO3- |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 3-(butanoylamino)benzoate |
| SMILES | CCCC(=O)Nc1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C11H13NO3/c1-2-4-10(13)12-9-6-3-5-8(7-9)11(14)15/h3,5-7H,2,4H2,1H3,(H,12,13)(H,14,15)/p-1 |
| InChIKey | ASXLJZIPYBUVFW-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |