C13H15N5O2 — CID 21369517
3-(butanoylamino)-N-(1,2,4-triazol-4-yl)benzamide (PubChem CID 21369517) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is 3-(butanoylamino)-N-(1,2,4-triazol-4-yl)benzamide.
| Compound Name | 3-(butanoylamino)-N-(1,2,4-triazol-4-yl)benzamide |
|---|---|
| PubChem CID | 21369517 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 3-(butanoylamino)-N-(1,2,4-triazol-4-yl)benzamide |
| SMILES | CCCC(=O)Nc1cccc(C(=O)Nn2cnnc2)c1 |
| InChI | InChI=1S/C13H15N5O2/c1-2-4-12(19)16-11-6-3-5-10(7-11)13(20)17-18-8-14-15-9-18/h3,5-9H,2,4H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | XGXLFSSUUCZLJL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |