C24H28N2O4 — CID 2979888
3-(5-ethylfuran-2-yl)-N-[3-[3-(5-ethylfuran-2-yl)propanoylamino]phenyl]propanamide (PubChem CID 2979888) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 3-(5-ethylfuran-2-yl)-N-[3-[3-(5-ethylfuran-2-yl)propanoylamino]phenyl]propanamide.
| Compound Name | 3-(5-ethylfuran-2-yl)-N-[3-[3-(5-ethylfuran-2-yl)propanoylamino]phenyl]propanamide |
|---|---|
| PubChem CID | 2979888 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 3-(5-ethylfuran-2-yl)-N-[3-[3-(5-ethylfuran-2-yl)propanoylamino]phenyl]propanamide |
| SMILES | CCc1ccc(CCC(=O)Nc2cccc(NC(=O)CCc3ccc(CC)o3)c2)o1 |
| InChI | InChI=1S/C24H28N2O4/c1-3-19-8-10-21(29-19)12-14-23(27)25-17-6-5-7-18(16-17)26-24(28)15-13-22-11-9-20(4-2)30-22/h5-11,16H,3-4,12-15H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | FOSQFBKRCUXZOK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |