C13H12FNO2 — CID 110697812
5-ethyl-N-(3-fluorophenyl)furan-2-carboxamide (PubChem CID 110697812) has the molecular formula C13H12FNO2 and a molecular weight of 233.24 g/mol. Its IUPAC name is 5-ethyl-N-(3-fluorophenyl)furan-2-carboxamide.
| Compound Name | 5-ethyl-N-(3-fluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 110697812 |
| Molecular Formula | C13H12FNO2 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 5-ethyl-N-(3-fluorophenyl)furan-2-carboxamide |
| SMILES | CCc1ccc(C(=O)Nc2cccc(F)c2)o1 |
| InChI | InChI=1S/C13H12FNO2/c1-2-11-6-7-12(17-11)13(16)15-10-5-3-4-9(14)8-10/h3-8H,2H2,1H3,(H,15,16) |
| InChIKey | JNOKBAMUGDLNFI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |