C16H27BO3 — CID 159161788
3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]butan-2-one (PubChem CID 159161788) has the molecular formula C16H27BO3 and a molecular weight of 278.20 g/mol. Its IUPAC name is 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]butan-2-one.
| Compound Name | 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]butan-2-one |
|---|---|
| PubChem CID | 159161788 |
| Molecular Formula | C16H27BO3 |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]butan-2-one |
| SMILES | CC(=O)C(C)C1CC=C(B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C16H27BO3/c1-11(12(2)18)13-7-9-14(10-8-13)17-19-15(3,4)16(5,6)20-17/h9,11,13H,7-8,10H2,1-6H3 |
| InChIKey | KKOQSQCZFDEJLT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|