C20H42BNO2S — CID 143146335
ethane;methanethiol;2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]pentan-3-amine (PubChem CID 143146335) has the molecular formula C20H42BNO2S and a molecular weight of 371.44 g/mol. Its IUPAC name is ethane;methanethiol;2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]pentan-3-amine.
| Compound Name | ethane;methanethiol;2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]pentan-3-amine |
|---|---|
| PubChem CID | 143146335 |
| Molecular Formula | C20H42BNO2S |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.30 |
| IUPAC Name | ethane;methanethiol;2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]pentan-3-amine |
| SMILES | CC.CCC(N)C(C)C1CC=C(B2OC(C)(C)C(C)(C)O2)CC1.CS |
| InChI | InChI=1S/C17H32BNO2.C2H6.CH4S/c1-7-15(19)12(2)13-8-10-14(11-9-13)18-20-16(3,4)17(5,6)21-18;2*1-2/h10,12-13,15H,7-9,11,19H2,1-6H3;1-2H3;2H,1H3 |
| InChIKey | MAWFKSVFEKJYOI-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|