C13H21B2O3 — CID 90049667
CID 90049667 (PubChem CID 90049667) has the molecular formula C13H21B2O3 and a molecular weight of 246.93 g/mol.
| Compound Name | CID 90049667 |
|---|---|
| PubChem CID | 90049667 |
| Molecular Formula | C13H21B2O3 |
| Molecular Weight | 246.93 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | — |
| SMILES | CC1(C)OB(C2=CCC([B]C=O)CC2)OC1(C)C |
| InChI | InChI=1S/C13H21B2O3/c1-12(2)13(3,4)18-15(17-12)11-7-5-10(6-8-11)14-9-16/h7,9-10H,5-6,8H2,1-4H3 |
| InChIKey | JCXFFPSXZQRINQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.93 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|