C13H20BNO2 — CID 99771074
(1S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carbonitrile (PubChem CID 99771074) has the molecular formula C13H20BNO2 and a molecular weight of 233.12 g/mol. Its IUPAC name is (1S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carbonitrile.
| Compound Name | (1S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carbonitrile |
|---|---|
| PubChem CID | 99771074 |
| Molecular Formula | C13H20BNO2 |
| Molecular Weight | 233.12 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | (1S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carbonitrile |
| SMILES | CC1(C)OB(C2=CC[C@@H](C#N)CC2)OC1(C)C |
| InChI | InChI=1S/C13H20BNO2/c1-12(2)13(3,4)17-14(16-12)11-7-5-10(9-15)6-8-11/h7,10H,5-6,8H2,1-4H3/t10-/m1/s1 |
| InChIKey | DHWWMTKTHOKXPV-SNVBAGLBSA-N |
| XLogP | 2.87 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.12 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|