C10H18BNO3 — CID 15264672
3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-1,2-oxazole (PubChem CID 15264672) has the molecular formula C10H18BNO3 and a molecular weight of 211.07 g/mol. Its IUPAC name is 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-1,2-oxazole.
| Compound Name | 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 15264672 |
| Molecular Formula | C10H18BNO3 |
| Molecular Weight | 211.07 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-1,2-oxazole |
| SMILES | CC1=NOC(B2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C10H18BNO3/c1-7-6-8(13-12-7)11-14-9(2,3)10(4,5)15-11/h8H,6H2,1-5H3 |
| InChIKey | XQVZDIJUOGFTIX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.07 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|