C21H30BN3O2 — CID 144590073
(4Z)-2-benzyl-1-methyl-3,6-dimethylidene-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7,8-dihydro-1,2,4-triazocine (PubChem CID 144590073) has the molecular formula C21H30BN3O2 and a molecular weight of 367.30 g/mol. Its IUPAC name is (4Z)-2-benzyl-1-methyl-3,6-dimethylidene-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7,8-dihydro-1,2,4-triazocine.
| Compound Name | (4Z)-2-benzyl-1-methyl-3,6-dimethylidene-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7,8-dihydro-1,2,4-triazocine |
|---|---|
| PubChem CID | 144590073 |
| Molecular Formula | C21H30BN3O2 |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | (4Z)-2-benzyl-1-methyl-3,6-dimethylidene-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7,8-dihydro-1,2,4-triazocine |
| SMILES | C=C1/C=N\C(=C)N(Cc2ccccc2)N(C)C(B2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C21H30BN3O2/c1-16-13-19(22-26-20(3,4)21(5,6)27-22)24(7)25(17(2)23-14-16)15-18-11-9-8-10-12-18/h8-12,14,19H,1-2,13,15H2,3-7H3/b23-14- |
| InChIKey | AWIVXIRVXNPFLL-UCQKPKSFSA-N |
| XLogP | 3.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|