C22H29ClNO- — CID 53351142
N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine chloride (PubChem CID 53351142) has the molecular formula C22H29ClNO- and a molecular weight of 358.93 g/mol. Its IUPAC name is N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine chloride.
| Compound Name | N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine chloride |
|---|---|
| PubChem CID | 53351142 |
| Molecular Formula | C22H29ClNO- |
| Molecular Weight | 358.93 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine chloride |
| SMILES | CC1(C)CC(N(CCc2ccccc2)Cc2ccccc2)CCO1.[Cl-] |
| InChI | InChI=1S/C22H29NO.ClH/c1-22(2)17-21(14-16-24-22)23(18-20-11-7-4-8-12-20)15-13-19-9-5-3-6-10-19;/h3-12,21H,13-18H2,1-2H3;1H/p-1 |
| InChIKey | WZTDSMYAKCOIOH-UHFFFAOYSA-M |
| XLogP | 1.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.93 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |