C23H35NO2 — CID 42654291
N-[2-(1-benzylcyclopentyl)ethyl]-N-(2,2-dimethyloxan-4-yl)acetamide (PubChem CID 42654291) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is N-[2-(1-benzylcyclopentyl)ethyl]-N-(2,2-dimethyloxan-4-yl)acetamide.
| Compound Name | N-[2-(1-benzylcyclopentyl)ethyl]-N-(2,2-dimethyloxan-4-yl)acetamide |
|---|---|
| PubChem CID | 42654291 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | N-[2-(1-benzylcyclopentyl)ethyl]-N-(2,2-dimethyloxan-4-yl)acetamide |
| SMILES | CC(=O)N(CCC1(Cc2ccccc2)CCCC1)C1CCOC(C)(C)C1 |
| InChI | InChI=1S/C23H35NO2/c1-19(25)24(21-11-16-26-22(2,3)18-21)15-14-23(12-7-8-13-23)17-20-9-5-4-6-10-20/h4-6,9-10,21H,7-8,11-18H2,1-3H3 |
| InChIKey | FLBNLMFFQQEWNT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |