C31H39BO2Si — CID 101486287
methyl-diphenyl-[(2S)-2-(2-phenylethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]silane (PubChem CID 101486287) has the molecular formula C31H39BO2Si and a molecular weight of 482.55 g/mol. Its IUPAC name is methyl-diphenyl-[(2S)-2-(2-phenylethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]silane.
| Compound Name | methyl-diphenyl-[(2S)-2-(2-phenylethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]silane |
|---|---|
| PubChem CID | 101486287 |
| Molecular Formula | C31H39BO2Si |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | methyl-diphenyl-[(2S)-2-(2-phenylethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]silane |
| SMILES | C=C(B1OC(C)(C)C(C)(C)O1)[C@H](CCc1ccccc1)C[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H39BO2Si/c1-25(32-33-30(2,3)31(4,5)34-32)27(23-22-26-16-10-7-11-17-26)24-35(6,28-18-12-8-13-19-28)29-20-14-9-15-21-29/h7-21,27H,1,22-24H2,2-6H3/t27-/m1/s1 |
| InChIKey | RDSFRHLOCSUUSP-HHHXNRCGSA-N |
| XLogP | 6.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|