C18H31BO3Si — CID 154719088
methoxy-dimethyl-[(1S)-3-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silane (PubChem CID 154719088) has the molecular formula C18H31BO3Si and a molecular weight of 334.34 g/mol. Its IUPAC name is methoxy-dimethyl-[(1S)-3-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silane.
| Compound Name | methoxy-dimethyl-[(1S)-3-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silane |
|---|---|
| PubChem CID | 154719088 |
| Molecular Formula | C18H31BO3Si |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | methoxy-dimethyl-[(1S)-3-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silane |
| SMILES | CO[Si](C)(C)[C@H](CCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H31BO3Si/c1-17(2)18(3,4)22-19(21-17)16(23(6,7)20-5)14-13-15-11-9-8-10-12-15/h8-12,16H,13-14H2,1-7H3/t16-/m1/s1 |
| InChIKey | ATVBHZVISXZOIJ-MRXNPFEDSA-N |
| XLogP | 4.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|