C28H40B2O4 — CID 165416659
4,4,5,5-tetramethyl-2-[(2R)-4-(4-phenylphenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-yl]-1,3,2-dioxaborolane (PubChem CID 165416659) has the molecular formula C28H40B2O4 and a molecular weight of 462.25 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(2R)-4-(4-phenylphenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(2R)-4-(4-phenylphenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 165416659 |
| Molecular Formula | C28H40B2O4 |
| Molecular Weight | 462.25 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(2R)-4-(4-phenylphenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-yl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C[C@H](CCc2ccc(-c3ccccc3)cc2)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C28H40B2O4/c1-25(2)26(3,4)32-29(31-25)20-24(30-33-27(5,6)28(7,8)34-30)19-16-21-14-17-23(18-15-21)22-12-10-9-11-13-22/h9-15,17-18,24H,16,19-20H2,1-8H3/t24-/m0/s1 |
| InChIKey | FEKAJKUNJGWXHJ-DEOSSOPVSA-N |
| XLogP | 6.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.25 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|