C25H42BNO3 — CID 122393403
2,2,6,6-tetramethyl-1-[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-yl]oxypiperidine (PubChem CID 122393403) has the molecular formula C25H42BNO3 and a molecular weight of 415.43 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-yl]oxypiperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-yl]oxypiperidine |
|---|---|
| PubChem CID | 122393403 |
| Molecular Formula | C25H42BNO3 |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.33 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-yl]oxypiperidine |
| SMILES | CC1(C)CCCC(C)(C)N1OC(CCc1ccccc1)CB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H42BNO3/c1-22(2)17-12-18-23(3,4)27(22)28-21(16-15-20-13-10-9-11-14-20)19-26-29-24(5,6)25(7,8)30-26/h9-11,13-14,21H,12,15-19H2,1-8H3 |
| InChIKey | GUTINKUHEYHATB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|