C17H24BNO2 — CID 146168343
(2S)-4-phenyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]butanenitrile (PubChem CID 146168343) has the molecular formula C17H24BNO2 and a molecular weight of 285.20 g/mol. Its IUPAC name is (2S)-4-phenyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]butanenitrile.
| Compound Name | (2S)-4-phenyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]butanenitrile |
|---|---|
| PubChem CID | 146168343 |
| Molecular Formula | C17H24BNO2 |
| Molecular Weight | 285.20 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | (2S)-4-phenyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]butanenitrile |
| SMILES | CC1(C)OB(C[C@H](C#N)CCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C17H24BNO2/c1-16(2)17(3,4)21-18(20-16)12-15(13-19)11-10-14-8-6-5-7-9-14/h5-9,15H,10-12H2,1-4H3/t15-/m1/s1 |
| InChIKey | RMPZAJGGUJIYBG-OAHLLOKOSA-N |
| XLogP | 3.85 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.20 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|