C16H27BNO2+ — CID 168920040
[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]azanium (PubChem CID 168920040) has the molecular formula C16H27BNO2+ and a molecular weight of 276.21 g/mol. Its IUPAC name is [(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]azanium.
| Compound Name | [(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]azanium |
|---|---|
| PubChem CID | 168920040 |
| Molecular Formula | C16H27BNO2+ |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | [(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]azanium |
| SMILES | CC1(C)OB([C@@H]([NH3+])CCCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C16H26BNO2/c1-15(2)16(3,4)20-17(19-15)14(18)12-8-11-13-9-6-5-7-10-13/h5-7,9-10,14H,8,11-12,18H2,1-4H3/p+1/t14-/m0/s1 |
| InChIKey | GJTZPCXCTOQSKW-AWEZNQCLSA-O |
| XLogP | 2.25 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|