C19H28BNO3 — CID 177297164
(3R)-2-methylidene-6-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanamide (PubChem CID 177297164) has the molecular formula C19H28BNO3 and a molecular weight of 329.25 g/mol. Its IUPAC name is (3R)-2-methylidene-6-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanamide.
| Compound Name | (3R)-2-methylidene-6-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanamide |
|---|---|
| PubChem CID | 177297164 |
| Molecular Formula | C19H28BNO3 |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | (3R)-2-methylidene-6-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanamide |
| SMILES | C=C(C(N)=O)[C@@H](CCCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H28BNO3/c1-14(17(21)22)16(13-9-12-15-10-7-6-8-11-15)20-23-18(2,3)19(4,5)24-20/h6-8,10-11,16H,1,9,12-13H2,2-5H3,(H2,21,22)/t16-/m1/s1 |
| InChIKey | YXQWRQUJAJCUCL-MRXNPFEDSA-N |
| XLogP | 3.51 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|