C19H29BN2O4 — CID 164574478
N-[(1R)-3-amino-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-4-phenylbutanamide (PubChem CID 164574478) has the molecular formula C19H29BN2O4 and a molecular weight of 360.26 g/mol. Its IUPAC name is N-[(1R)-3-amino-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-4-phenylbutanamide.
| Compound Name | N-[(1R)-3-amino-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 164574478 |
| Molecular Formula | C19H29BN2O4 |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | N-[(1R)-3-amino-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-4-phenylbutanamide |
| SMILES | CC1(C)OB([C@H](CC(N)=O)NC(=O)CCCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C19H29BN2O4/c1-18(2)19(3,4)26-20(25-18)15(13-16(21)23)22-17(24)12-8-11-14-9-6-5-7-10-14/h5-7,9-10,15H,8,11-13H2,1-4H3,(H2,21,23)(H,22,24)/t15-/m0/s1 |
| InChIKey | UMBQNSDYOVTRHO-HNNXBMFYSA-N |
| XLogP | 2.00 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|