C13H25BN2O4 — CID 164574492
N-[3-amino-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]butanamide (PubChem CID 164574492) has the molecular formula C13H25BN2O4 and a molecular weight of 284.17 g/mol. Its IUPAC name is N-[3-amino-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]butanamide.
| Compound Name | N-[3-amino-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]butanamide |
|---|---|
| PubChem CID | 164574492 |
| Molecular Formula | C13H25BN2O4 |
| Molecular Weight | 284.17 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-[3-amino-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]butanamide |
| SMILES | CCCC(=O)NC(CC(N)=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H25BN2O4/c1-6-7-11(18)16-9(8-10(15)17)14-19-12(2,3)13(4,5)20-14/h9H,6-8H2,1-5H3,(H2,15,17)(H,16,18) |
| InChIKey | VECBIWQXTMAFFI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.17 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|